About 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide
2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide (PubChem CID 116675423) has the molecular formula C18H28N2O
and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide.
Molecular Properties
| Compound Name | 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide |
| PubChem CID | 116675423 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide |
| SMILES | CC(C)c1ccc(NC(=O)C(C)C2CNC2)c(C(C)C)c1 |
| InChI | InChI=1S/C18H28N2O/c1-11(2)14-6-7-17(16(8-14)12(3)4)20-18(21)13(5)15-9-19-10-15/h6-8,11-13,15,19H,9-10H2,1-5H3,(H,20,21) |
| InChIKey | PHXXSUFFLPTCPY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide?
The IUPAC name of 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide (CID 116675423) is 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide.
What is the SMILES notation for 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide?
The canonical SMILES for 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide is CC(C)c1ccc(NC(=O)C(C)C2CNC2)c(C(C)C)c1.
What is the InChIKey of 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide?
The InChIKey is PHXXSUFFLPTCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O/c1-11(2)14-6-7-17(16(8-14)12(3)4)20-18(21)13(5)15-9-19-10-15/h6-8,11-13,15,19H,9-10H2,1-5H3,(H,20,21).
What are the key properties of 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide?
2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide has a molecular weight of 288.44 g/mol, XLogP of 3.73, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yl)-N-[2,4-di(propan-2-yl)phenyl]propanamide is sourced from PubChem (CID 116675423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).