C13H19N3O3 — CID 79202126
N-(4,5-dimethyl-2-nitrophenyl)-2-methyl-3-(methylamino)propanamide (PubChem CID 79202126) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-2-methyl-3-(methylamino)propanamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-2-methyl-3-(methylamino)propanamide |
|---|---|
| PubChem CID | 79202126 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-2-methyl-3-(methylamino)propanamide |
| SMILES | CNCC(C)C(=O)Nc1cc(C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O3/c1-8-5-11(12(16(18)19)6-9(8)2)15-13(17)10(3)7-14-4/h5-6,10,14H,7H2,1-4H3,(H,15,17) |
| InChIKey | BHNFPRWICYEJMU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|