C12H12N4O4 — CID 107856913
N-(cyanomethyl)-N'-(4,5-dimethyl-2-nitrophenyl)oxamide (PubChem CID 107856913) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(4,5-dimethyl-2-nitrophenyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(4,5-dimethyl-2-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 107856913 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-(cyanomethyl)-N'-(4,5-dimethyl-2-nitrophenyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCC#N)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C12H12N4O4/c1-7-5-9(10(16(19)20)6-8(7)2)15-12(18)11(17)14-4-3-13/h5-6H,4H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | CLGJFJFLSTYXMP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|