C17H18N4O5 — CID 17194005
N-[4-(2,4-dinitroanilino)phenyl]-3-methylbutanamide (PubChem CID 17194005) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is N-[4-(2,4-dinitroanilino)phenyl]-3-methylbutanamide.
| Compound Name | N-[4-(2,4-dinitroanilino)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 17194005 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[4-(2,4-dinitroanilino)phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N4O5/c1-11(2)9-17(22)19-13-5-3-12(4-6-13)18-15-8-7-14(20(23)24)10-16(15)21(25)26/h3-8,10-11,18H,9H2,1-2H3,(H,19,22) |
| InChIKey | DNAFXVVIXSQRHN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|