C13H12N4O4 — CID 102249231
4-N-(2,4-dinitrophenyl)-1-N-methylbenzene-1,4-diamine (PubChem CID 102249231) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-N-(2,4-dinitrophenyl)-1-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(2,4-dinitrophenyl)-1-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 102249231 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-N-(2,4-dinitrophenyl)-1-N-methylbenzene-1,4-diamine |
| SMILES | CNc1ccc(Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H12N4O4/c1-14-9-2-4-10(5-3-9)15-12-7-6-11(16(18)19)8-13(12)17(20)21/h2-8,14-15H,1H3 |
| InChIKey | WWDRVMOWDAHHHV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|