C39H30N6O10 — CID 3089132
N-[4-[4-[2-[4-[4-(2,4-dinitroanilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-2,4-dinitroaniline (PubChem CID 3089132) has the molecular formula C39H30N6O10 and a molecular weight of 742.70 g/mol. Its IUPAC name is N-[4-[4-[2-[4-[4-(2,4-dinitroanilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-2,4-dinitroaniline.
| Compound Name | N-[4-[4-[2-[4-[4-(2,4-dinitroanilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3089132 |
| Molecular Formula | C39H30N6O10 |
| Molecular Weight | 742.70 g/mol |
| Exact Mass | 742.20 |
| IUPAC Name | N-[4-[4-[2-[4-[4-(2,4-dinitroanilino)phenoxy]phenyl]propan-2-yl]phenoxy]phenyl]-2,4-dinitroaniline |
| SMILES | CC(C)(c1ccc(Oc2ccc(Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)cc1)c1ccc(Oc2ccc(Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C39H30N6O10/c1-39(2,25-3-13-31(14-4-25)54-33-17-7-27(8-18-33)40-35-21-11-29(42(46)47)23-37(35)44(50)51)26-5-15-32(16-6-26)55-34-19-9-28(10-20-34)41-36-22-12-30(43(48)49)24-38(36)45(52)53/h3-24,40-41H,1-2H3 |
| InChIKey | DDBNHCMEJSQYRJ-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 215.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.70 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|