C19H15N4O7S- — CID 4290014
5-(2,4-dinitroanilino)-2-(4-methylanilino)benzenesulfonate (PubChem CID 4290014) has the molecular formula C19H15N4O7S- and a molecular weight of 443.42 g/mol. Its IUPAC name is 5-(2,4-dinitroanilino)-2-(4-methylanilino)benzenesulfonate.
| Compound Name | 5-(2,4-dinitroanilino)-2-(4-methylanilino)benzenesulfonate |
|---|---|
| PubChem CID | 4290014 |
| Molecular Formula | C19H15N4O7S- |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 5-(2,4-dinitroanilino)-2-(4-methylanilino)benzenesulfonate |
| SMILES | Cc1ccc(Nc2ccc(Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N4O7S/c1-12-2-4-13(5-3-12)20-17-8-6-14(10-19(17)31(28,29)30)21-16-9-7-15(22(24)25)11-18(16)23(26)27/h2-11,20-21H,1H3,(H,28,29,30)/p-1 |
| InChIKey | VZWWGAXAVADXQI-UHFFFAOYSA-M |
| XLogP | 4.20 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|