C19H13N4NaO9S — CID 90475209
sodium 2-anilino-5-(4-carboxy-2,6-dinitroanilino)benzenesulfonate (PubChem CID 90475209) has the molecular formula C19H13N4NaO9S and a molecular weight of 496.39 g/mol. Its IUPAC name is sodium 2-anilino-5-(4-carboxy-2,6-dinitroanilino)benzenesulfonate.
| Compound Name | sodium 2-anilino-5-(4-carboxy-2,6-dinitroanilino)benzenesulfonate |
|---|---|
| PubChem CID | 90475209 |
| Molecular Formula | C19H13N4NaO9S |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | sodium 2-anilino-5-(4-carboxy-2,6-dinitroanilino)benzenesulfonate |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(Nc2ccc(Nc3ccccc3)c(S(=O)(=O)[O-])c2)c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C19H14N4O9S.Na/c24-19(25)11-8-15(22(26)27)18(16(9-11)23(28)29)21-13-6-7-14(17(10-13)33(30,31)32)20-12-4-2-1-3-5-12;/h1-10,20-21H,(H,24,25)(H,30,31,32);/q;+1/p-1 |
| InChIKey | DQKWZGAUMHSKOC-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 204.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|