C20H24N4O4 — CID 86934684
N-(1-amino-2,4-dimethyl-1-oxopentan-2-yl)-4-anilino-3-nitrobenzamide (PubChem CID 86934684) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethyl-1-oxopentan-2-yl)-4-anilino-3-nitrobenzamide.
| Compound Name | N-(1-amino-2,4-dimethyl-1-oxopentan-2-yl)-4-anilino-3-nitrobenzamide |
|---|---|
| PubChem CID | 86934684 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-(1-amino-2,4-dimethyl-1-oxopentan-2-yl)-4-anilino-3-nitrobenzamide |
| SMILES | CC(C)CC(C)(NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1)C(N)=O |
| InChI | InChI=1S/C20H24N4O4/c1-13(2)12-20(3,19(21)26)23-18(25)14-9-10-16(17(11-14)24(27)28)22-15-7-5-4-6-8-15/h4-11,13,22H,12H2,1-3H3,(H2,21,26)(H,23,25) |
| InChIKey | SICVYYILZPBQGM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|