sodium 2,4-dianilino-5-nitrobenzenesulfonate

C18H14N3NaO5S — CID 21233384

IUPACsodium 2,4-dianilino-5-nitrobenzenesulfonate
SMILESO=[N+]([O-])c1cc(S(=O)(=O)[O-])c(Nc2ccccc2)cc1Nc1ccccc1.[Na+]
InChIInChI=1S/C18H15N3O5S.Na/c22-21(23)17-12-18(27(24,25)26)16(20-14-9-5-2-6-10-14)11-15(17)19-13-7-3-1-4-8-13;/h1-12,19-20H,(H,24,25,26);/q;+1/p-1
InChIKeyVYKOQKHMTQXCQD-UHFFFAOYSA-M
MW407.38 g/mol
LogP0.99
Rot. Bonds6

About sodium 2,4-dianilino-5-nitrobenzenesulfonate

sodium 2,4-dianilino-5-nitrobenzenesulfonate (PubChem CID 21233384) has the molecular formula C18H14N3NaO5S and a molecular weight of 407.38 g/mol. Its IUPAC name is sodium 2,4-dianilino-5-nitrobenzenesulfonate.

Molecular Properties

Compound Namesodium 2,4-dianilino-5-nitrobenzenesulfonate
PubChem CID21233384
Molecular FormulaC18H14N3NaO5S
Molecular Weight407.38 g/mol
Exact Mass407.06
IUPAC Namesodium 2,4-dianilino-5-nitrobenzenesulfonate
SMILESO=[N+]([O-])c1cc(S(=O)(=O)[O-])c(Nc2ccccc2)cc1Nc1ccccc1.[Na+]
InChIInChI=1S/C18H15N3O5S.Na/c22-21(23)17-12-18(27(24,25)26)16(20-14-9-5-2-6-10-14)11-15(17)19-13-7-3-1-4-8-13;/h1-12,19-20H,(H,24,25,26);/q;+1/p-1
InChIKeyVYKOQKHMTQXCQD-UHFFFAOYSA-M
XLogP0.99
TPSA124.40 Ų
H-Bond Donors2
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500407.38
LogP ≤ 50.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 2,4-dianilino-5-nitrobenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2,4-dianilino-5-nitrobenzenesulfonate?
The IUPAC name of sodium 2,4-dianilino-5-nitrobenzenesulfonate (CID 21233384) is sodium 2,4-dianilino-5-nitrobenzenesulfonate.
What is the SMILES notation for sodium 2,4-dianilino-5-nitrobenzenesulfonate?
The canonical SMILES for sodium 2,4-dianilino-5-nitrobenzenesulfonate is O=[N+]([O-])c1cc(S(=O)(=O)[O-])c(Nc2ccccc2)cc1Nc1ccccc1.[Na+].
What is the InChIKey of sodium 2,4-dianilino-5-nitrobenzenesulfonate?
The InChIKey is VYKOQKHMTQXCQD-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15N3O5S.Na/c22-21(23)17-12-18(27(24,25)26)16(20-14-9-5-2-6-10-14)11-15(17)19-13-7-3-1-4-8-13;/h1-12,19-20H,(H,24,25,26);/q;+1/p-1.
What are the key properties of sodium 2,4-dianilino-5-nitrobenzenesulfonate?
sodium 2,4-dianilino-5-nitrobenzenesulfonate has a molecular weight of 407.38 g/mol, XLogP of 0.99, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2,4-dianilino-5-nitrobenzenesulfonate is sourced from PubChem (CID 21233384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).