C24H20N7NaO11S3 — CID 5489760
sodium 5-(2-nitro-4-sulfamoylanilino)-2-[4-(2-nitro-4-sulfamoylanilino)anilino]benzenesulfonate (PubChem CID 5489760) has the molecular formula C24H20N7NaO11S3 and a molecular weight of 701.65 g/mol. Its IUPAC name is sodium 5-(2-nitro-4-sulfamoylanilino)-2-[4-(2-nitro-4-sulfamoylanilino)anilino]benzenesulfonate.
| Compound Name | sodium 5-(2-nitro-4-sulfamoylanilino)-2-[4-(2-nitro-4-sulfamoylanilino)anilino]benzenesulfonate |
|---|---|
| PubChem CID | 5489760 |
| Molecular Formula | C24H20N7NaO11S3 |
| Molecular Weight | 701.65 g/mol |
| Exact Mass | 701.03 |
| IUPAC Name | sodium 5-(2-nitro-4-sulfamoylanilino)-2-[4-(2-nitro-4-sulfamoylanilino)anilino]benzenesulfonate |
| SMILES | NS(=O)(=O)c1ccc(Nc2ccc(Nc3ccc(Nc4ccc(S(N)(=O)=O)cc4[N+](=O)[O-])cc3S(=O)(=O)[O-])cc2)c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C24H21N7O11S3.Na/c25-43(36,37)17-6-9-19(22(12-17)30(32)33)27-14-1-3-15(4-2-14)28-21-8-5-16(11-24(21)45(40,41)42)29-20-10-7-18(44(26,38)39)13-23(20)31(34)35;/h1-13,27-29H,(H2,25,36,37)(H2,26,38,39)(H,40,41,42);/q;+1/p-1 |
| InChIKey | JZEKQMNTDOYRIO-UHFFFAOYSA-M |
| XLogP | -0.06 |
| TPSA | 299.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.65 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|