C15H14F3N3O4S — CID 133347698
3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzenesulfonamide (PubChem CID 133347698) has the molecular formula C15H14F3N3O4S and a molecular weight of 389.36 g/mol. Its IUPAC name is 3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzenesulfonamide.
| Compound Name | 3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzenesulfonamide |
|---|---|
| PubChem CID | 133347698 |
| Molecular Formula | C15H14F3N3O4S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2cccc(CCC(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14F3N3O4S/c16-15(17,18)7-6-10-2-1-3-11(8-10)20-13-5-4-12(26(19,24)25)9-14(13)21(22)23/h1-5,8-9,20H,6-7H2,(H2,19,24,25) |
| InChIKey | MKPCNFDIKKAVKW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|