C17H16F3N3O3 — CID 133347713
N-methyl-3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzamide (PubChem CID 133347713) has the molecular formula C17H16F3N3O3 and a molecular weight of 367.33 g/mol. Its IUPAC name is N-methyl-3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzamide.
| Compound Name | N-methyl-3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzamide |
|---|---|
| PubChem CID | 133347713 |
| Molecular Formula | C17H16F3N3O3 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-methyl-3-nitro-4-[3-(3,3,3-trifluoropropyl)anilino]benzamide |
| SMILES | CNC(=O)c1ccc(Nc2cccc(CCC(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16F3N3O3/c1-21-16(24)12-5-6-14(15(10-12)23(25)26)22-13-4-2-3-11(9-13)7-8-17(18,19)20/h2-6,9-10,22H,7-8H2,1H3,(H,21,24) |
| InChIKey | RBIYOHSKTMBQJR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|