C13H12F3N5O2 — CID 133347703
5-nitro-2-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 133347703) has the molecular formula C13H12F3N5O2 and a molecular weight of 327.27 g/mol. Its IUPAC name is 5-nitro-2-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133347703 |
| Molecular Formula | C13H12F3N5O2 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 5-nitro-2-N-[3-(3,3,3-trifluoropropyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2cccc(CCC(F)(F)F)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12F3N5O2/c14-13(15,16)5-4-8-2-1-3-9(6-8)19-12-18-7-10(21(22)23)11(17)20-12/h1-3,6-7H,4-5H2,(H3,17,18,19,20) |
| InChIKey | ZHIOPMDDIAKGNM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|