C17H13N7O2 — CID 133384857
5-nitro-2-N-(1-phenylbenzimidazol-5-yl)pyrimidine-2,4-diamine (PubChem CID 133384857) has the molecular formula C17H13N7O2 and a molecular weight of 347.34 g/mol. Its IUPAC name is 5-nitro-2-N-(1-phenylbenzimidazol-5-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-(1-phenylbenzimidazol-5-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133384857 |
| Molecular Formula | C17H13N7O2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 5-nitro-2-N-(1-phenylbenzimidazol-5-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccc3c(c2)ncn3-c2ccccc2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N7O2/c18-16-15(24(25)26)9-19-17(22-16)21-11-6-7-14-13(8-11)20-10-23(14)12-4-2-1-3-5-12/h1-10H,(H3,18,19,21,22) |
| InChIKey | RHZXDLSNUVYFGS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|