C12H10F3N5O2 — CID 133331779
5-nitro-2-N-[3-(2,2,2-trifluoroethyl)phenyl]pyrimidine-2,4-diamine (PubChem CID 133331779) has the molecular formula C12H10F3N5O2 and a molecular weight of 313.24 g/mol. Its IUPAC name is 5-nitro-2-N-[3-(2,2,2-trifluoroethyl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[3-(2,2,2-trifluoroethyl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133331779 |
| Molecular Formula | C12H10F3N5O2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 5-nitro-2-N-[3-(2,2,2-trifluoroethyl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Nc2cccc(CC(F)(F)F)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10F3N5O2/c13-12(14,15)5-7-2-1-3-8(4-7)18-11-17-6-9(20(21)22)10(16)19-11/h1-4,6H,5H2,(H3,16,17,18,19) |
| InChIKey | IGJKSMPJGDCCFX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|