C11H9F2N5O2 — CID 143177853
2-N-[(3,5-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 143177853) has the molecular formula C11H9F2N5O2 and a molecular weight of 281.22 g/mol. Its IUPAC name is 2-N-[(3,5-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(3,5-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143177853 |
| Molecular Formula | C11H9F2N5O2 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-N-[(3,5-difluorophenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2cc(F)cc(F)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9F2N5O2/c12-7-1-6(2-8(13)3-7)4-15-11-16-5-9(18(19)20)10(14)17-11/h1-3,5H,4H2,(H3,14,15,16,17) |
| InChIKey | GXAWQXWHSOICHF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|