C15H14FN7O2 — CID 133274418
2-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 133274418) has the molecular formula C15H14FN7O2 and a molecular weight of 343.32 g/mol. Its IUPAC name is 2-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133274418 |
| Molecular Formula | C15H14FN7O2 |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1nccn1-c1ccc(CNc2ncc([N+](=O)[O-])c(N)n2)cc1F |
| InChI | InChI=1S/C15H14FN7O2/c1-9-18-4-5-22(9)12-3-2-10(6-11(12)16)7-19-15-20-8-13(23(24)25)14(17)21-15/h2-6,8H,7H2,1H3,(H3,17,19,20,21) |
| InChIKey | HQZWPMFNZRUPSP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|