C16H13FN6O3 — CID 133274461
2-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 133274461) has the molecular formula C16H13FN6O3 and a molecular weight of 356.32 g/mol. Its IUPAC name is 2-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133274461 |
| Molecular Formula | C16H13FN6O3 |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccc(Oc3cccnc3)c(F)c2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13FN6O3/c17-12-6-10(3-4-14(12)26-11-2-1-5-19-8-11)7-20-16-21-9-13(23(24)25)15(18)22-16/h1-6,8-9H,7H2,(H3,18,20,21,22) |
| InChIKey | SBDUCJLWPWZRBH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|