C19H13FN4O6 — CID 47739998
N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3,5-dinitrobenzamide (PubChem CID 47739998) has the molecular formula C19H13FN4O6 and a molecular weight of 412.33 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3,5-dinitrobenzamide.
| Compound Name | N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 47739998 |
| Molecular Formula | C19H13FN4O6 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3,5-dinitrobenzamide |
| SMILES | O=C(NCc1ccc(Oc2cccnc2)c(F)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13FN4O6/c20-17-6-12(3-4-18(17)30-16-2-1-5-21-11-16)10-22-19(25)13-7-14(23(26)27)9-15(8-13)24(28)29/h1-9,11H,10H2,(H,22,25) |
| InChIKey | HTVJXMJZBXOKCY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|