C18H15FN4O3 — CID 133274466
methyl 6-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]pyridazine-3-carboxylate (PubChem CID 133274466) has the molecular formula C18H15FN4O3 and a molecular weight of 354.34 g/mol. Its IUPAC name is methyl 6-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]pyridazine-3-carboxylate.
| Compound Name | methyl 6-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 133274466 |
| Molecular Formula | C18H15FN4O3 |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | methyl 6-[(3-fluoro-4-pyridin-3-yloxyphenyl)methylamino]pyridazine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCc2ccc(Oc3cccnc3)c(F)c2)nn1 |
| InChI | InChI=1S/C18H15FN4O3/c1-25-18(24)15-5-7-17(23-22-15)21-10-12-4-6-16(14(19)9-12)26-13-3-2-8-20-11-13/h2-9,11H,10H2,1H3,(H,21,23) |
| InChIKey | QGZFXEWZDHPEJJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |