C22H22F2N4O — CID 111846945
1-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine (PubChem CID 111846945) has the molecular formula C22H22F2N4O and a molecular weight of 396.44 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111846945 |
| Molecular Formula | C22H22F2N4O |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(C)c(F)c1)NCc1ccc(Oc2cccnc2)c(F)c1 |
| InChI | InChI=1S/C22H22F2N4O/c1-15-5-6-16(10-19(15)23)12-27-22(25-2)28-13-17-7-8-21(20(24)11-17)29-18-4-3-9-26-14-18/h3-11,14H,12-13H2,1-2H3,(H2,25,27,28) |
| InChIKey | NOJAOGHCPNLDHK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|