C17H22FIN4O2 — CID 110939795
1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide (PubChem CID 110939795) has the molecular formula C17H22FIN4O2 and a molecular weight of 460.29 g/mol. Its IUPAC name is 1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110939795 |
| Molecular Formula | C17H22FIN4O2 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-(2-methoxyethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCOC)NCc1ccc(Oc2cccnc2)c(F)c1.I |
| InChI | InChI=1S/C17H21FN4O2.HI/c1-19-17(21-8-9-23-2)22-11-13-5-6-16(15(18)10-13)24-14-4-3-7-20-12-14;/h3-7,10,12H,8-9,11H2,1-2H3,(H2,19,21,22);1H |
| InChIKey | IMSHJBMLIQXZQU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|