C21H19F3N4O — CID 111903459
1-[(2,5-difluorophenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine (PubChem CID 111903459) has the molecular formula C21H19F3N4O and a molecular weight of 400.40 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111903459 |
| Molecular Formula | C21H19F3N4O |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc(Oc2cccnc2)c(F)c1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C21H19F3N4O/c1-25-21(28-12-15-10-16(22)5-6-18(15)23)27-11-14-4-7-20(19(24)9-14)29-17-3-2-8-26-13-17/h2-10,13H,11-12H2,1H3,(H2,25,27,28) |
| InChIKey | IRTGKUKYOYOGSV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|