C21H21FIN7O — CID 111013794
1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111013794) has the molecular formula C21H21FIN7O and a molecular weight of 533.35 g/mol. Its IUPAC name is 1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013794 |
| Molecular Formula | C21H21FIN7O |
| Molecular Weight | 533.35 g/mol |
| Exact Mass | 533.08 |
| IUPAC Name | 1-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Oc2cccnc2)c(F)c1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C21H20FN7O.HI/c1-23-21(26-14-20-28-27-19-6-2-3-10-29(19)20)25-12-15-7-8-18(17(22)11-15)30-16-5-4-9-24-13-16;/h2-11,13H,12,14H2,1H3,(H2,23,25,26);1H |
| InChIKey | VZPOSPSZOZYQPR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|