C23H26FN3O3 — CID 166195405
N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]oxamide (PubChem CID 166195405) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]oxamide.
| Compound Name | N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 166195405 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]oxamide |
| SMILES | O=C(NCc1ccc(Oc2cccnc2)c(F)c1)C(=O)NC1CCC2CCCC2C1 |
| InChI | InChI=1S/C23H26FN3O3/c24-20-11-15(6-9-21(20)30-19-5-2-10-25-14-19)13-26-22(28)23(29)27-18-8-7-16-3-1-4-17(16)12-18/h2,5-6,9-11,14,16-18H,1,3-4,7-8,12-13H2,(H,26,28)(H,27,29) |
| InChIKey | XADPOEJQOBDVAK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|