C21H28Cl2FN3O2 — CID 119864547
N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119864547) has the molecular formula C21H28Cl2FN3O2 and a molecular weight of 444.38 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119864547 |
| Molecular Formula | C21H28Cl2FN3O2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | N-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCc1ccc(Oc2cccnc2)c(F)c1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C21H26FN3O2.2ClH/c1-15(17-6-9-23-10-7-17)11-21(26)25-13-16-4-5-20(19(22)12-16)27-18-3-2-8-24-14-18;;/h2-5,8,12,14-15,17,23H,6-7,9-11,13H2,1H3,(H,25,26);2*1H |
| InChIKey | IJYJUDQDFNICPD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |