C21H15FN4O4 — CID 48814202
1-(1,3-dioxoisoindol-5-yl)-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]urea (PubChem CID 48814202) has the molecular formula C21H15FN4O4 and a molecular weight of 406.37 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-5-yl)-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]urea.
| Compound Name | 1-(1,3-dioxoisoindol-5-yl)-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 48814202 |
| Molecular Formula | C21H15FN4O4 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 1-(1,3-dioxoisoindol-5-yl)-3-[(3-fluoro-4-pyridin-3-yloxyphenyl)methyl]urea |
| SMILES | O=C(NCc1ccc(Oc2cccnc2)c(F)c1)Nc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C21H15FN4O4/c22-17-8-12(3-6-18(17)30-14-2-1-7-23-11-14)10-24-21(29)25-13-4-5-15-16(9-13)20(28)26-19(15)27/h1-9,11H,10H2,(H2,24,25,29)(H,26,27,28) |
| InChIKey | RJZCWDRDVNAQDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|