C14H15N5O4 — CID 133286933
2-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 133286933) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is 2-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133286933 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccc3c(c2)OCCCO3)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O4/c15-13-10(19(20)21)8-17-14(18-13)16-7-9-2-3-11-12(6-9)23-5-1-4-22-11/h2-3,6,8H,1,4-5,7H2,(H3,15,16,17,18) |
| InChIKey | KILQNLBKJZTTJN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|