C13H16N6O2 — CID 86806521
2-N-[[2-(dimethylamino)phenyl]methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 86806521) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-N-[[2-(dimethylamino)phenyl]methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[[2-(dimethylamino)phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 86806521 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-N-[[2-(dimethylamino)phenyl]methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CN(C)c1ccccc1CNc1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C13H16N6O2/c1-18(2)10-6-4-3-5-9(10)7-15-13-16-8-11(19(20)21)12(14)17-13/h3-6,8H,7H2,1-2H3,(H3,14,15,16,17) |
| InChIKey | STTUGXJJSWRAQJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|