C13H16N6O2 — CID 133346872
2-N-(2-anilinopropyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 133346872) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-N-(2-anilinopropyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-anilinopropyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133346872 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-N-(2-anilinopropyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CC(CNc1ncc([N+](=O)[O-])c(N)n1)Nc1ccccc1 |
| InChI | InChI=1S/C13H16N6O2/c1-9(17-10-5-3-2-4-6-10)7-15-13-16-8-11(19(20)21)12(14)18-13/h2-6,8-9,17H,7H2,1H3,(H3,14,15,16,18) |
| InChIKey | KZMJDQNOPHTUJH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|