C16H19N5O2 — CID 60501528
5-nitro-2-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine (PubChem CID 60501528) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-nitro-2-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 60501528 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-nitro-2-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCC2(c3ccccc3)CCCC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N5O2/c17-14-13(21(22)23)10-18-15(20-14)19-11-16(8-4-5-9-16)12-6-2-1-3-7-12/h1-3,6-7,10H,4-5,8-9,11H2,(H3,17,18,19,20) |
| InChIKey | CDVKWHDXGPQIOX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|