C15H17N5O3 — CID 133308770
2-N-[(2-cyclobutyloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 133308770) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-N-[(2-cyclobutyloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(2-cyclobutyloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133308770 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-N-[(2-cyclobutyloxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccccc2OC2CCC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N5O3/c16-14-12(20(21)22)9-18-15(19-14)17-8-10-4-1-2-7-13(10)23-11-5-3-6-11/h1-2,4,7,9,11H,3,5-6,8H2,(H3,16,17,18,19) |
| InChIKey | SKYHFEHOHJHEMK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|