C15H17N3O — CID 133308784
N-[(2-cyclobutyloxyphenyl)methyl]pyrazin-2-amine (PubChem CID 133308784) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[(2-cyclobutyloxyphenyl)methyl]pyrazin-2-amine.
| Compound Name | N-[(2-cyclobutyloxyphenyl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 133308784 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2-cyclobutyloxyphenyl)methyl]pyrazin-2-amine |
| SMILES | c1ccc(OC2CCC2)c(CNc2cnccn2)c1 |
| InChI | InChI=1S/C15H17N3O/c1-2-7-14(19-13-5-3-6-13)12(4-1)10-18-15-11-16-8-9-17-15/h1-2,4,7-9,11,13H,3,5-6,10H2,(H,17,18) |
| InChIKey | FTKCZZINNQANHQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |