C16H24IN3O — CID 120969677
N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120969677) has the molecular formula C16H24IN3O and a molecular weight of 401.29 g/mol. Its IUPAC name is N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120969677 |
| Molecular Formula | C16H24IN3O |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[(2-cyclopentyloxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccccc1OC1CCCC1.I |
| InChI | InChI=1S/C16H23N3O.HI/c1-19-11-10-17-16(19)18-12-13-6-2-5-9-15(13)20-14-7-3-4-8-14;/h2,5-6,9,14H,3-4,7-8,10-12H2,1H3,(H,17,18);1H |
| InChIKey | XHFPTPGLENIJJP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|