C18H29IN4 — CID 120971050
N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120971050) has the molecular formula C18H29IN4 and a molecular weight of 428.36 g/mol. Its IUPAC name is N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120971050 |
| Molecular Formula | C18H29IN4 |
| Molecular Weight | 428.36 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccccc1CN1CCCCCC1.I |
| InChI | InChI=1S/C18H28N4.HI/c1-21-13-10-19-18(21)20-14-16-8-4-5-9-17(16)15-22-11-6-2-3-7-12-22;/h4-5,8-9H,2-3,6-7,10-15H2,1H3,(H,19,20);1H |
| InChIKey | RBBRQMDCDRAYEP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|