C15H20IN5 — CID 120969350
N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120969350) has the molecular formula C15H20IN5 and a molecular weight of 397.26 g/mol. Its IUPAC name is N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120969350 |
| Molecular Formula | C15H20IN5 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[[2-(imidazol-1-ylmethyl)phenyl]methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ccccc1Cn1ccnc1.I |
| InChI | InChI=1S/C15H19N5.HI/c1-19-8-7-17-15(19)18-10-13-4-2-3-5-14(13)11-20-9-6-16-12-20;/h2-6,9,12H,7-8,10-11H2,1H3,(H,17,18);1H |
| InChIKey | PADNWCLOENBHOZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|