C8H13N5O2S — CID 133305075
2-N-(3-methylsulfanylpropyl)-5-nitropyrimidine-2,4-diamine (PubChem CID 133305075) has the molecular formula C8H13N5O2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-N-(3-methylsulfanylpropyl)-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-methylsulfanylpropyl)-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133305075 |
| Molecular Formula | C8H13N5O2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-N-(3-methylsulfanylpropyl)-5-nitropyrimidine-2,4-diamine |
| SMILES | CSCCCNc1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C8H13N5O2S/c1-16-4-2-3-10-8-11-5-6(13(14)15)7(9)12-8/h5H,2-4H2,1H3,(H3,9,10,11,12) |
| InChIKey | AQYDEGVZKADFMX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|