C9H15N5O3 — CID 97248819
(2S)-3-[(4-amino-5-nitropyrimidin-2-yl)amino]-3-methylbutan-2-ol (PubChem CID 97248819) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is (2S)-3-[(4-amino-5-nitropyrimidin-2-yl)amino]-3-methylbutan-2-ol.
| Compound Name | (2S)-3-[(4-amino-5-nitropyrimidin-2-yl)amino]-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 97248819 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (2S)-3-[(4-amino-5-nitropyrimidin-2-yl)amino]-3-methylbutan-2-ol |
| SMILES | C[C@H](O)C(C)(C)Nc1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C9H15N5O3/c1-5(15)9(2,3)13-8-11-4-6(14(16)17)7(10)12-8/h4-5,15H,1-3H3,(H3,10,11,12,13)/t5-/m0/s1 |
| InChIKey | JHQAUJDEQXXWCM-YFKPBYRVSA-N |
| XLogP | 0.54 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|