C14H21N7O2 — CID 133477506
2-N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 133477506) has the molecular formula C14H21N7O2 and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133477506 |
| Molecular Formula | C14H21N7O2 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-N-[1-(1-tert-butyl-3-methylpyrazol-4-yl)ethyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Cc1nn(C(C)(C)C)cc1C(C)Nc1ncc([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C14H21N7O2/c1-8(10-7-20(14(3,4)5)19-9(10)2)17-13-16-6-11(21(22)23)12(15)18-13/h6-8H,1-5H3,(H3,15,16,17,18) |
| InChIKey | MBLNADZWHUHWPH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|