C12H14N6O4 — CID 133276828
2-[(4-amino-5-nitropyrimidin-2-yl)amino]-N-(furan-2-ylmethyl)propanamide (PubChem CID 133276828) has the molecular formula C12H14N6O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-[(4-amino-5-nitropyrimidin-2-yl)amino]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 2-[(4-amino-5-nitropyrimidin-2-yl)amino]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 133276828 |
| Molecular Formula | C12H14N6O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[(4-amino-5-nitropyrimidin-2-yl)amino]-N-(furan-2-ylmethyl)propanamide |
| SMILES | CC(Nc1ncc([N+](=O)[O-])c(N)n1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H14N6O4/c1-7(11(19)14-5-8-3-2-4-22-8)16-12-15-6-9(18(20)21)10(13)17-12/h2-4,6-7H,5H2,1H3,(H,14,19)(H3,13,15,16,17) |
| InChIKey | REQZUWOADNBOES-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|