C8H11NO3 — CID 93242884
(2R)-N-(furan-2-ylmethyl)-2-hydroxypropanamide (PubChem CID 93242884) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is (2R)-N-(furan-2-ylmethyl)-2-hydroxypropanamide.
| Compound Name | (2R)-N-(furan-2-ylmethyl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 93242884 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | (2R)-N-(furan-2-ylmethyl)-2-hydroxypropanamide |
| SMILES | C[C@@H](O)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C8H11NO3/c1-6(10)8(11)9-5-7-3-2-4-12-7/h2-4,6,10H,5H2,1H3,(H,9,11)/t6-/m1/s1 |
| InChIKey | YGYIFHSIYHLTDC-ZCFIWIBFSA-N |
| XLogP | 0.28 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |