C9H12BrNO2 — CID 25219706
2-bromo-N-(furan-2-ylmethyl)butanamide (PubChem CID 25219706) has the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. Its IUPAC name is 2-bromo-N-(furan-2-ylmethyl)butanamide.
| Compound Name | 2-bromo-N-(furan-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 25219706 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2-bromo-N-(furan-2-ylmethyl)butanamide |
| SMILES | CCC(Br)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C9H12BrNO2/c1-2-8(10)9(12)11-6-7-4-3-5-13-7/h3-5,8H,2,6H2,1H3,(H,11,12) |
| InChIKey | YSGKOBRBIUBVRW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|