C8H14N4S — CID 116795959
2-N-(3-methylsulfanylpropyl)pyrimidine-2,4-diamine (PubChem CID 116795959) has the molecular formula C8H14N4S and a molecular weight of 198.30 g/mol. Its IUPAC name is 2-N-(3-methylsulfanylpropyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-methylsulfanylpropyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116795959 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.30 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 2-N-(3-methylsulfanylpropyl)pyrimidine-2,4-diamine |
| SMILES | CSCCCNc1nccc(N)n1 |
| InChI | InChI=1S/C8H14N4S/c1-13-6-2-4-10-8-11-5-3-7(9)12-8/h3,5H,2,4,6H2,1H3,(H3,9,10,11,12) |
| InChIKey | PYXZLNQGSHVLFB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|