C10H19N5 — CID 116795730
2-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine (PubChem CID 116795730) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 116795730 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCCNc1nccc(N)n1 |
| InChI | InChI=1S/C10H19N5/c1-15(2)8-4-3-6-12-10-13-7-5-9(11)14-10/h5,7H,3-4,6,8H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | MSFZBBYILYFOQS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|