C10H20N6 — CID 80908527
N-(2-hydrazinylpyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 80908527) has the molecular formula C10H20N6 and a molecular weight of 224.31 g/mol. Its IUPAC name is N-(2-hydrazinylpyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-(2-hydrazinylpyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 80908527 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N-(2-hydrazinylpyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNc1ccnc(NN)n1 |
| InChI | InChI=1S/C10H20N6/c1-16(2)8-4-3-6-12-9-5-7-13-10(14-9)15-11/h5,7H,3-4,6,8,11H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | OWFICPADQPFGPR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|