C8H15N5O — CID 80944536
2-hydrazinyl-N-(3-methoxypropyl)pyrimidin-4-amine (PubChem CID 80944536) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-hydrazinyl-N-(3-methoxypropyl)pyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-(3-methoxypropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80944536 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 2-hydrazinyl-N-(3-methoxypropyl)pyrimidin-4-amine |
| SMILES | COCCCNc1ccnc(NN)n1 |
| InChI | InChI=1S/C8H15N5O/c1-14-6-2-4-10-7-3-5-11-8(12-7)13-9/h3,5H,2,4,6,9H2,1H3,(H2,10,11,12,13) |
| InChIKey | FJLIJBFJRHDYSE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|