C11H18N4O — CID 112882663
4-N-(3-methoxypropyl)-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112882663) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-methoxypropyl)-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112882663 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 4-N-(3-methoxypropyl)-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1nccc(NCCCOC)n1 |
| InChI | InChI=1S/C11H18N4O/c1-3-6-13-11-14-8-5-10(15-11)12-7-4-9-16-2/h3,5,8H,1,4,6-7,9H2,2H3,(H2,12,13,14,15) |
| InChIKey | BZJOXVYPRACYFV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|