C16H21Cl2N5 — CID 91447813
2-N-(2,5-dichlorophenyl)-4-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine (PubChem CID 91447813) has the molecular formula C16H21Cl2N5 and a molecular weight of 354.29 g/mol. Its IUPAC name is 2-N-(2,5-dichlorophenyl)-4-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,5-dichlorophenyl)-4-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 91447813 |
| Molecular Formula | C16H21Cl2N5 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-N-(2,5-dichlorophenyl)-4-N-[4-(dimethylamino)butyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCCNc1ccnc(Nc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C16H21Cl2N5/c1-23(2)10-4-3-8-19-15-7-9-20-16(22-15)21-14-11-12(17)5-6-13(14)18/h5-7,9,11H,3-4,8,10H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | OGGAISXDRYCHME-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|