C16H18ClF3N4 — CID 112900400
2-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N-pentylpyrimidine-2,4-diamine (PubChem CID 112900400) has the molecular formula C16H18ClF3N4 and a molecular weight of 358.80 g/mol. Its IUPAC name is 2-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N-pentylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N-pentylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112900400 |
| Molecular Formula | C16H18ClF3N4 |
| Molecular Weight | 358.80 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-N-[2-chloro-5-(trifluoromethyl)phenyl]-4-N-pentylpyrimidine-2,4-diamine |
| SMILES | CCCCCNc1ccnc(Nc2cc(C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C16H18ClF3N4/c1-2-3-4-8-21-14-7-9-22-15(24-14)23-13-10-11(16(18,19)20)5-6-12(13)17/h5-7,9-10H,2-4,8H2,1H3,(H2,21,22,23,24) |
| InChIKey | GKBDXZKNGGMAFZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|